C13H15ClF2N2O — CID 119603606
N-[2-(aminomethyl)cyclopentyl]-2-chloro-4,5-difluorobenzamide (PubChem CID 119603606) has the molecular formula C13H15ClF2N2O and a molecular weight of 288.73 g/mol. Its IUPAC name is N-[2-(aminomethyl)cyclopentyl]-2-chloro-4,5-difluorobenzamide.
| Compound Name | N-[2-(aminomethyl)cyclopentyl]-2-chloro-4,5-difluorobenzamide |
|---|---|
| PubChem CID | 119603606 |
| Molecular Formula | C13H15ClF2N2O |
| Molecular Weight | 288.73 g/mol |
| Exact Mass | 288.08 |
| IUPAC Name | N-[2-(aminomethyl)cyclopentyl]-2-chloro-4,5-difluorobenzamide |
| SMILES | NCC1CCCC1NC(=O)c1cc(F)c(F)cc1Cl |
| InChI | InChI=1S/C13H15ClF2N2O/c14-9-5-11(16)10(15)4-8(9)13(19)18-12-3-1-2-7(12)6-17/h4-5,7,12H,1-3,6,17H2,(H,18,19) |
| InChIKey | ZGITWPPLNDLPBA-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.73 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|