C13H15F3N2O — CID 79749551
N-[2-(aminomethyl)cyclopentyl]-2,3,4-trifluorobenzamide (PubChem CID 79749551) has the molecular formula C13H15F3N2O and a molecular weight of 272.27 g/mol. Its IUPAC name is N-[2-(aminomethyl)cyclopentyl]-2,3,4-trifluorobenzamide.
| Compound Name | N-[2-(aminomethyl)cyclopentyl]-2,3,4-trifluorobenzamide |
|---|---|
| PubChem CID | 79749551 |
| Molecular Formula | C13H15F3N2O |
| Molecular Weight | 272.27 g/mol |
| Exact Mass | 272.11 |
| IUPAC Name | N-[2-(aminomethyl)cyclopentyl]-2,3,4-trifluorobenzamide |
| SMILES | NCC1CCCC1NC(=O)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C13H15F3N2O/c14-9-5-4-8(11(15)12(9)16)13(19)18-10-3-1-2-7(10)6-17/h4-5,7,10H,1-3,6,17H2,(H,18,19) |
| InChIKey | DHYFAGIYAKRVAF-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.27 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|