C15H20F2N2O — CID 82816320
N-[2-(aminomethyl)cyclohexyl]-2,6-difluoro-3-methylbenzamide (PubChem CID 82816320) has the molecular formula C15H20F2N2O and a molecular weight of 282.33 g/mol. Its IUPAC name is N-[2-(aminomethyl)cyclohexyl]-2,6-difluoro-3-methylbenzamide.
| Compound Name | N-[2-(aminomethyl)cyclohexyl]-2,6-difluoro-3-methylbenzamide |
|---|---|
| PubChem CID | 82816320 |
| Molecular Formula | C15H20F2N2O |
| Molecular Weight | 282.33 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | N-[2-(aminomethyl)cyclohexyl]-2,6-difluoro-3-methylbenzamide |
| SMILES | Cc1ccc(F)c(C(=O)NC2CCCCC2CN)c1F |
| InChI | InChI=1S/C15H20F2N2O/c1-9-6-7-11(16)13(14(9)17)15(20)19-12-5-3-2-4-10(12)8-18/h6-7,10,12H,2-5,8,18H2,1H3,(H,19,20) |
| InChIKey | DZGHGDAEZQISQS-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.33 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |