C14H19ClFIN2O — CID 119612060
N-[2-(aminomethyl)cyclohexyl]-3-fluoro-4-iodobenzamide;hydrochloride (PubChem CID 119612060) has the molecular formula C14H19ClFIN2O and a molecular weight of 412.67 g/mol. Its IUPAC name is N-[2-(aminomethyl)cyclohexyl]-3-fluoro-4-iodobenzamide;hydrochloride.
| Compound Name | N-[2-(aminomethyl)cyclohexyl]-3-fluoro-4-iodobenzamide;hydrochloride |
|---|---|
| PubChem CID | 119612060 |
| Molecular Formula | C14H19ClFIN2O |
| Molecular Weight | 412.67 g/mol |
| Exact Mass | 412.02 |
| IUPAC Name | N-[2-(aminomethyl)cyclohexyl]-3-fluoro-4-iodobenzamide;hydrochloride |
| SMILES | Cl.NCC1CCCCC1NC(=O)c1ccc(I)c(F)c1 |
| InChI | InChI=1S/C14H18FIN2O.ClH/c15-11-7-9(5-6-12(11)16)14(19)18-13-4-2-1-3-10(13)8-17;/h5-7,10,13H,1-4,8,17H2,(H,18,19);1H |
| InChIKey | ALGCTQSKDGZJNN-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.67 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|