C15H23ClN2O3 — CID 119602992
N-[2-(aminomethyl)cyclopentyl]-3,4-dimethoxybenzamide;hydrochloride (PubChem CID 119602992) has the molecular formula C15H23ClN2O3 and a molecular weight of 314.81 g/mol. Its IUPAC name is N-[2-(aminomethyl)cyclopentyl]-3,4-dimethoxybenzamide;hydrochloride.
| Compound Name | N-[2-(aminomethyl)cyclopentyl]-3,4-dimethoxybenzamide;hydrochloride |
|---|---|
| PubChem CID | 119602992 |
| Molecular Formula | C15H23ClN2O3 |
| Molecular Weight | 314.81 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | N-[2-(aminomethyl)cyclopentyl]-3,4-dimethoxybenzamide;hydrochloride |
| SMILES | COc1ccc(C(=O)NC2CCCC2CN)cc1OC.Cl |
| InChI | InChI=1S/C15H22N2O3.ClH/c1-19-13-7-6-10(8-14(13)20-2)15(18)17-12-5-3-4-11(12)9-16;/h6-8,11-12H,3-5,9,16H2,1-2H3,(H,17,18);1H |
| InChIKey | HXNWZBQWQDJNJU-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.81 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |