C16H24ClN3O4 — CID 119601304
N-[2-(aminomethyl)cyclopentyl]-4-(2-amino-2-oxoethoxy)-3-methoxybenzamide;hydrochloride (PubChem CID 119601304) has the molecular formula C16H24ClN3O4 and a molecular weight of 357.84 g/mol. Its IUPAC name is N-[2-(aminomethyl)cyclopentyl]-4-(2-amino-2-oxoethoxy)-3-methoxybenzamide;hydrochloride.
| Compound Name | N-[2-(aminomethyl)cyclopentyl]-4-(2-amino-2-oxoethoxy)-3-methoxybenzamide;hydrochloride |
|---|---|
| PubChem CID | 119601304 |
| Molecular Formula | C16H24ClN3O4 |
| Molecular Weight | 357.84 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | N-[2-(aminomethyl)cyclopentyl]-4-(2-amino-2-oxoethoxy)-3-methoxybenzamide;hydrochloride |
| SMILES | COc1cc(C(=O)NC2CCCC2CN)ccc1OCC(N)=O.Cl |
| InChI | InChI=1S/C16H23N3O4.ClH/c1-22-14-7-10(5-6-13(14)23-9-15(18)20)16(21)19-12-4-2-3-11(12)8-17;/h5-7,11-12H,2-4,8-9,17H2,1H3,(H2,18,20)(H,19,21);1H |
| InChIKey | DOBLZDVKYILBEF-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 116.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.84 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |