C17H27ClN2O4 — CID 119610035
N-[2-(aminomethyl)cyclohexyl]-3,4,5-trimethoxybenzamide;hydrochloride (PubChem CID 119610035) has the molecular formula C17H27ClN2O4 and a molecular weight of 358.87 g/mol. Its IUPAC name is N-[2-(aminomethyl)cyclohexyl]-3,4,5-trimethoxybenzamide;hydrochloride.
| Compound Name | N-[2-(aminomethyl)cyclohexyl]-3,4,5-trimethoxybenzamide;hydrochloride |
|---|---|
| PubChem CID | 119610035 |
| Molecular Formula | C17H27ClN2O4 |
| Molecular Weight | 358.87 g/mol |
| Exact Mass | 358.17 |
| IUPAC Name | N-[2-(aminomethyl)cyclohexyl]-3,4,5-trimethoxybenzamide;hydrochloride |
| SMILES | COc1cc(C(=O)NC2CCCCC2CN)cc(OC)c1OC.Cl |
| InChI | InChI=1S/C17H26N2O4.ClH/c1-21-14-8-12(9-15(22-2)16(14)23-3)17(20)19-13-7-5-4-6-11(13)10-18;/h8-9,11,13H,4-7,10,18H2,1-3H3,(H,19,20);1H |
| InChIKey | KIOQWKMYNMHPLR-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.87 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |