C11H16ClIN2OS — CID 119601552
N-[2-(aminomethyl)cyclopentyl]-5-iodothiophene-3-carboxamide;hydrochloride (PubChem CID 119601552) has the molecular formula C11H16ClIN2OS and a molecular weight of 386.69 g/mol. Its IUPAC name is N-[2-(aminomethyl)cyclopentyl]-5-iodothiophene-3-carboxamide;hydrochloride.
| Compound Name | N-[2-(aminomethyl)cyclopentyl]-5-iodothiophene-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119601552 |
| Molecular Formula | C11H16ClIN2OS |
| Molecular Weight | 386.69 g/mol |
| Exact Mass | 385.97 |
| IUPAC Name | N-[2-(aminomethyl)cyclopentyl]-5-iodothiophene-3-carboxamide;hydrochloride |
| SMILES | Cl.NCC1CCCC1NC(=O)c1csc(I)c1 |
| InChI | InChI=1S/C11H15IN2OS.ClH/c12-10-4-8(6-16-10)11(15)14-9-3-1-2-7(9)5-13;/h4,6-7,9H,1-3,5,13H2,(H,14,15);1H |
| InChIKey | KDSOORFFAYSVLG-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.69 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|