C17H22ClN3O3S2 — CID 119603184
N-[2-(aminomethyl)cyclopentyl]-3-(thiophen-2-ylsulfonylamino)benzamide;hydrochloride (PubChem CID 119603184) has the molecular formula C17H22ClN3O3S2 and a molecular weight of 415.97 g/mol. Its IUPAC name is N-[2-(aminomethyl)cyclopentyl]-3-(thiophen-2-ylsulfonylamino)benzamide;hydrochloride.
| Compound Name | N-[2-(aminomethyl)cyclopentyl]-3-(thiophen-2-ylsulfonylamino)benzamide;hydrochloride |
|---|---|
| PubChem CID | 119603184 |
| Molecular Formula | C17H22ClN3O3S2 |
| Molecular Weight | 415.97 g/mol |
| Exact Mass | 415.08 |
| IUPAC Name | N-[2-(aminomethyl)cyclopentyl]-3-(thiophen-2-ylsulfonylamino)benzamide;hydrochloride |
| SMILES | Cl.NCC1CCCC1NC(=O)c1cccc(NS(=O)(=O)c2cccs2)c1 |
| InChI | InChI=1S/C17H21N3O3S2.ClH/c18-11-13-5-2-7-15(13)19-17(21)12-4-1-6-14(10-12)20-25(22,23)16-8-3-9-24-16;/h1,3-4,6,8-10,13,15,20H,2,5,7,11,18H2,(H,19,21);1H |
| InChIKey | FBJVUQWIMWILAW-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.97 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |