C15H20ClN3O3S2 — CID 119995200
N-(3-amino-2-methylpropyl)-3-(thiophen-2-ylsulfonylamino)benzamide;hydrochloride (PubChem CID 119995200) has the molecular formula C15H20ClN3O3S2 and a molecular weight of 389.93 g/mol. Its IUPAC name is N-(3-amino-2-methylpropyl)-3-(thiophen-2-ylsulfonylamino)benzamide;hydrochloride.
| Compound Name | N-(3-amino-2-methylpropyl)-3-(thiophen-2-ylsulfonylamino)benzamide;hydrochloride |
|---|---|
| PubChem CID | 119995200 |
| Molecular Formula | C15H20ClN3O3S2 |
| Molecular Weight | 389.93 g/mol |
| Exact Mass | 389.06 |
| IUPAC Name | N-(3-amino-2-methylpropyl)-3-(thiophen-2-ylsulfonylamino)benzamide;hydrochloride |
| SMILES | CC(CN)CNC(=O)c1cccc(NS(=O)(=O)c2cccs2)c1.Cl |
| InChI | InChI=1S/C15H19N3O3S2.ClH/c1-11(9-16)10-17-15(19)12-4-2-5-13(8-12)18-23(20,21)14-6-3-7-22-14;/h2-8,11,18H,9-10,16H2,1H3,(H,17,19);1H |
| InChIKey | DWFNFLBFTQKOHB-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.93 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |