C19H17FN2O4S2 — CID 78897097
N-[2-(4-fluorophenyl)-2-hydroxyethyl]-3-(thiophen-2-ylsulfonylamino)benzamide (PubChem CID 78897097) has the molecular formula C19H17FN2O4S2 and a molecular weight of 420.49 g/mol. Its IUPAC name is N-[2-(4-fluorophenyl)-2-hydroxyethyl]-3-(thiophen-2-ylsulfonylamino)benzamide.
| Compound Name | N-[2-(4-fluorophenyl)-2-hydroxyethyl]-3-(thiophen-2-ylsulfonylamino)benzamide |
|---|---|
| PubChem CID | 78897097 |
| Molecular Formula | C19H17FN2O4S2 |
| Molecular Weight | 420.49 g/mol |
| Exact Mass | 420.06 |
| IUPAC Name | N-[2-(4-fluorophenyl)-2-hydroxyethyl]-3-(thiophen-2-ylsulfonylamino)benzamide |
| SMILES | O=C(NCC(O)c1ccc(F)cc1)c1cccc(NS(=O)(=O)c2cccs2)c1 |
| InChI | InChI=1S/C19H17FN2O4S2/c20-15-8-6-13(7-9-15)17(23)12-21-19(24)14-3-1-4-16(11-14)22-28(25,26)18-5-2-10-27-18/h1-11,17,22-23H,12H2,(H,21,24) |
| InChIKey | VKAHNBAFEVMQNC-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.49 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |