C17H24ClN3O3S2 — CID 119667025
N-(1-aminohexan-2-yl)-3-(thiophen-2-ylsulfonylamino)benzamide;hydrochloride (PubChem CID 119667025) has the molecular formula C17H24ClN3O3S2 and a molecular weight of 417.98 g/mol. Its IUPAC name is N-(1-aminohexan-2-yl)-3-(thiophen-2-ylsulfonylamino)benzamide;hydrochloride.
| Compound Name | N-(1-aminohexan-2-yl)-3-(thiophen-2-ylsulfonylamino)benzamide;hydrochloride |
|---|---|
| PubChem CID | 119667025 |
| Molecular Formula | C17H24ClN3O3S2 |
| Molecular Weight | 417.98 g/mol |
| Exact Mass | 417.09 |
| IUPAC Name | N-(1-aminohexan-2-yl)-3-(thiophen-2-ylsulfonylamino)benzamide;hydrochloride |
| SMILES | CCCCC(CN)NC(=O)c1cccc(NS(=O)(=O)c2cccs2)c1.Cl |
| InChI | InChI=1S/C17H23N3O3S2.ClH/c1-2-3-7-15(12-18)19-17(21)13-6-4-8-14(11-13)20-25(22,23)16-9-5-10-24-16;/h4-6,8-11,15,20H,2-3,7,12,18H2,1H3,(H,19,21);1H |
| InChIKey | IISJFZPQXNWZKB-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.98 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |