C19H25ClFN3O3S — CID 119666444
N-(1-aminohexan-2-yl)-3-[(2-fluorophenyl)sulfamoyl]benzamide;hydrochloride (PubChem CID 119666444) has the molecular formula C19H25ClFN3O3S and a molecular weight of 429.95 g/mol. Its IUPAC name is N-(1-aminohexan-2-yl)-3-[(2-fluorophenyl)sulfamoyl]benzamide;hydrochloride.
| Compound Name | N-(1-aminohexan-2-yl)-3-[(2-fluorophenyl)sulfamoyl]benzamide;hydrochloride |
|---|---|
| PubChem CID | 119666444 |
| Molecular Formula | C19H25ClFN3O3S |
| Molecular Weight | 429.95 g/mol |
| Exact Mass | 429.13 |
| IUPAC Name | N-(1-aminohexan-2-yl)-3-[(2-fluorophenyl)sulfamoyl]benzamide;hydrochloride |
| SMILES | CCCCC(CN)NC(=O)c1cccc(S(=O)(=O)Nc2ccccc2F)c1.Cl |
| InChI | InChI=1S/C19H24FN3O3S.ClH/c1-2-3-8-15(13-21)22-19(24)14-7-6-9-16(12-14)27(25,26)23-18-11-5-4-10-17(18)20;/h4-7,9-12,15,23H,2-3,8,13,21H2,1H3,(H,22,24);1H |
| InChIKey | CQMGXJXXHARRQF-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.95 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |