C14H24ClN3O3S2 — CID 119610735
N-[2-(aminomethyl)cyclohexyl]-2-(thiophen-2-ylsulfonylamino)propanamide;hydrochloride (PubChem CID 119610735) has the molecular formula C14H24ClN3O3S2 and a molecular weight of 381.95 g/mol. Its IUPAC name is N-[2-(aminomethyl)cyclohexyl]-2-(thiophen-2-ylsulfonylamino)propanamide;hydrochloride.
| Compound Name | N-[2-(aminomethyl)cyclohexyl]-2-(thiophen-2-ylsulfonylamino)propanamide;hydrochloride |
|---|---|
| PubChem CID | 119610735 |
| Molecular Formula | C14H24ClN3O3S2 |
| Molecular Weight | 381.95 g/mol |
| Exact Mass | 381.09 |
| IUPAC Name | N-[2-(aminomethyl)cyclohexyl]-2-(thiophen-2-ylsulfonylamino)propanamide;hydrochloride |
| SMILES | CC(NS(=O)(=O)c1cccs1)C(=O)NC1CCCCC1CN.Cl |
| InChI | InChI=1S/C14H23N3O3S2.ClH/c1-10(17-22(19,20)13-7-4-8-21-13)14(18)16-12-6-3-2-5-11(12)9-15;/h4,7-8,10-12,17H,2-3,5-6,9,15H2,1H3,(H,16,18);1H |
| InChIKey | CXZUPJXUJYADJJ-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.95 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |