C16H25ClN4O2 — CID 119602707
N-[2-(aminomethyl)cyclopentyl]-2-(phenylcarbamoylamino)propanamide;hydrochloride (PubChem CID 119602707) has the molecular formula C16H25ClN4O2 and a molecular weight of 340.86 g/mol. Its IUPAC name is N-[2-(aminomethyl)cyclopentyl]-2-(phenylcarbamoylamino)propanamide;hydrochloride.
| Compound Name | N-[2-(aminomethyl)cyclopentyl]-2-(phenylcarbamoylamino)propanamide;hydrochloride |
|---|---|
| PubChem CID | 119602707 |
| Molecular Formula | C16H25ClN4O2 |
| Molecular Weight | 340.86 g/mol |
| Exact Mass | 340.17 |
| IUPAC Name | N-[2-(aminomethyl)cyclopentyl]-2-(phenylcarbamoylamino)propanamide;hydrochloride |
| SMILES | CC(NC(=O)Nc1ccccc1)C(=O)NC1CCCC1CN.Cl |
| InChI | InChI=1S/C16H24N4O2.ClH/c1-11(15(21)20-14-9-5-6-12(14)10-17)18-16(22)19-13-7-3-2-4-8-13;/h2-4,7-8,11-12,14H,5-6,9-10,17H2,1H3,(H,20,21)(H2,18,19,22);1H |
| InChIKey | COFGXJHAMLSHIK-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.86 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |