C17H27ClN2O — CID 119601012
N-[2-(aminomethyl)cyclopentyl]-3-methyl-2-phenylbutanamide;hydrochloride (PubChem CID 119601012) has the molecular formula C17H27ClN2O and a molecular weight of 310.87 g/mol. Its IUPAC name is N-[2-(aminomethyl)cyclopentyl]-3-methyl-2-phenylbutanamide;hydrochloride.
| Compound Name | N-[2-(aminomethyl)cyclopentyl]-3-methyl-2-phenylbutanamide;hydrochloride |
|---|---|
| PubChem CID | 119601012 |
| Molecular Formula | C17H27ClN2O |
| Molecular Weight | 310.87 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | N-[2-(aminomethyl)cyclopentyl]-3-methyl-2-phenylbutanamide;hydrochloride |
| SMILES | CC(C)C(C(=O)NC1CCCC1CN)c1ccccc1.Cl |
| InChI | InChI=1S/C17H26N2O.ClH/c1-12(2)16(13-7-4-3-5-8-13)17(20)19-15-10-6-9-14(15)11-18;/h3-5,7-8,12,14-16H,6,9-11,18H2,1-2H3,(H,19,20);1H |
| InChIKey | JYLXVDBPSMWKRW-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.87 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |