C15H23ClN2O2S — CID 119609161
N-[2-(aminomethyl)cyclohexyl]-4-oxo-4-thiophen-2-ylbutanamide;hydrochloride (PubChem CID 119609161) has the molecular formula C15H23ClN2O2S and a molecular weight of 330.88 g/mol. Its IUPAC name is N-[2-(aminomethyl)cyclohexyl]-4-oxo-4-thiophen-2-ylbutanamide;hydrochloride.
| Compound Name | N-[2-(aminomethyl)cyclohexyl]-4-oxo-4-thiophen-2-ylbutanamide;hydrochloride |
|---|---|
| PubChem CID | 119609161 |
| Molecular Formula | C15H23ClN2O2S |
| Molecular Weight | 330.88 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | N-[2-(aminomethyl)cyclohexyl]-4-oxo-4-thiophen-2-ylbutanamide;hydrochloride |
| SMILES | Cl.NCC1CCCCC1NC(=O)CCC(=O)c1cccs1 |
| InChI | InChI=1S/C15H22N2O2S.ClH/c16-10-11-4-1-2-5-12(11)17-15(19)8-7-13(18)14-6-3-9-20-14;/h3,6,9,11-12H,1-2,4-5,7-8,10,16H2,(H,17,19);1H |
| InChIKey | BISGNJAJSBHCMZ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.88 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |