C18H22ClN3O3S2 — CID 119457637
N-(8-azabicyclo[3.2.1]octan-3-yl)-3-(thiophen-2-ylsulfonylamino)benzamide;hydrochloride (PubChem CID 119457637) has the molecular formula C18H22ClN3O3S2 and a molecular weight of 427.98 g/mol. Its IUPAC name is N-(8-azabicyclo[3.2.1]octan-3-yl)-3-(thiophen-2-ylsulfonylamino)benzamide;hydrochloride.
| Compound Name | N-(8-azabicyclo[3.2.1]octan-3-yl)-3-(thiophen-2-ylsulfonylamino)benzamide;hydrochloride |
|---|---|
| PubChem CID | 119457637 |
| Molecular Formula | C18H22ClN3O3S2 |
| Molecular Weight | 427.98 g/mol |
| Exact Mass | 427.08 |
| IUPAC Name | N-(8-azabicyclo[3.2.1]octan-3-yl)-3-(thiophen-2-ylsulfonylamino)benzamide;hydrochloride |
| SMILES | Cl.O=C(NC1CC2CCC(C1)N2)c1cccc(NS(=O)(=O)c2cccs2)c1 |
| InChI | InChI=1S/C18H21N3O3S2.ClH/c22-18(20-16-10-13-6-7-14(11-16)19-13)12-3-1-4-15(9-12)21-26(23,24)17-5-2-8-25-17;/h1-5,8-9,13-14,16,19,21H,6-7,10-11H2,(H,20,22);1H |
| InChIKey | SQNVAUZZWQSEQS-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.98 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |