C11H14INO2S — CID 104956640
N-[(1S,2S)-2-hydroxycyclohexyl]-5-iodothiophene-3-carboxamide (PubChem CID 104956640) has the molecular formula C11H14INO2S and a molecular weight of 351.21 g/mol. Its IUPAC name is N-[(1S,2S)-2-hydroxycyclohexyl]-5-iodothiophene-3-carboxamide.
| Compound Name | N-[(1S,2S)-2-hydroxycyclohexyl]-5-iodothiophene-3-carboxamide |
|---|---|
| PubChem CID | 104956640 |
| Molecular Formula | C11H14INO2S |
| Molecular Weight | 351.21 g/mol |
| Exact Mass | 350.98 |
| IUPAC Name | N-[(1S,2S)-2-hydroxycyclohexyl]-5-iodothiophene-3-carboxamide |
| SMILES | O=C(N[C@H]1CCCC[C@@H]1O)c1csc(I)c1 |
| InChI | InChI=1S/C11H14INO2S/c12-10-5-7(6-16-10)11(15)13-8-3-1-2-4-9(8)14/h5-6,8-9,14H,1-4H2,(H,13,15)/t8-,9-/m0/s1 |
| InChIKey | RGHMMDDCCFAPDN-IUCAKERBSA-N |
| XLogP | 2.39 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.21 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|