C11H14INOS — CID 78948345
N-(cyclopentylmethyl)-5-iodothiophene-3-carboxamide (PubChem CID 78948345) has the molecular formula C11H14INOS and a molecular weight of 335.21 g/mol. Its IUPAC name is N-(cyclopentylmethyl)-5-iodothiophene-3-carboxamide.
| Compound Name | N-(cyclopentylmethyl)-5-iodothiophene-3-carboxamide |
|---|---|
| PubChem CID | 78948345 |
| Molecular Formula | C11H14INOS |
| Molecular Weight | 335.21 g/mol |
| Exact Mass | 334.98 |
| IUPAC Name | N-(cyclopentylmethyl)-5-iodothiophene-3-carboxamide |
| SMILES | O=C(NCC1CCCC1)c1csc(I)c1 |
| InChI | InChI=1S/C11H14INOS/c12-10-5-9(7-15-10)11(14)13-6-8-3-1-2-4-8/h5,7-8H,1-4,6H2,(H,13,14) |
| InChIKey | DGAUXMIIURVSRH-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.21 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|