C14H21IN2OS — CID 71844646
5-iodo-N-[[(2R)-1-(2-methylpropyl)pyrrolidin-2-yl]methyl]thiophene-3-carboxamide (PubChem CID 71844646) has the molecular formula C14H21IN2OS and a molecular weight of 392.31 g/mol. Its IUPAC name is 5-iodo-N-[[(2R)-1-(2-methylpropyl)pyrrolidin-2-yl]methyl]thiophene-3-carboxamide.
| Compound Name | 5-iodo-N-[[(2R)-1-(2-methylpropyl)pyrrolidin-2-yl]methyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 71844646 |
| Molecular Formula | C14H21IN2OS |
| Molecular Weight | 392.31 g/mol |
| Exact Mass | 392.04 |
| IUPAC Name | 5-iodo-N-[[(2R)-1-(2-methylpropyl)pyrrolidin-2-yl]methyl]thiophene-3-carboxamide |
| SMILES | CC(C)CN1CCC[C@@H]1CNC(=O)c1csc(I)c1 |
| InChI | InChI=1S/C14H21IN2OS/c1-10(2)8-17-5-3-4-12(17)7-16-14(18)11-6-13(15)19-9-11/h6,9-10,12H,3-5,7-8H2,1-2H3,(H,16,18)/t12-/m1/s1 |
| InChIKey | HEAKUJIGDSGXDR-GFCCVEGCSA-N |
| XLogP | 3.20 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.31 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|