C13H17IN2OS — CID 78950614
N-[(1-cyclopropylpyrrolidin-3-yl)methyl]-5-iodothiophene-3-carboxamide (PubChem CID 78950614) has the molecular formula C13H17IN2OS and a molecular weight of 376.26 g/mol. Its IUPAC name is N-[(1-cyclopropylpyrrolidin-3-yl)methyl]-5-iodothiophene-3-carboxamide.
| Compound Name | N-[(1-cyclopropylpyrrolidin-3-yl)methyl]-5-iodothiophene-3-carboxamide |
|---|---|
| PubChem CID | 78950614 |
| Molecular Formula | C13H17IN2OS |
| Molecular Weight | 376.26 g/mol |
| Exact Mass | 376.01 |
| IUPAC Name | N-[(1-cyclopropylpyrrolidin-3-yl)methyl]-5-iodothiophene-3-carboxamide |
| SMILES | O=C(NCC1CCN(C2CC2)C1)c1csc(I)c1 |
| InChI | InChI=1S/C13H17IN2OS/c14-12-5-10(8-18-12)13(17)15-6-9-3-4-16(7-9)11-1-2-11/h5,8-9,11H,1-4,6-7H2,(H,15,17) |
| InChIKey | ZBDBCFATSPSOSV-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.26 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|