C14H19IN2O — CID 8839724
N-[[(2R)-1-ethylpyrrolidin-2-yl]methyl]-3-iodobenzamide (PubChem CID 8839724) has the molecular formula C14H19IN2O and a molecular weight of 358.22 g/mol. Its IUPAC name is N-[[(2R)-1-ethylpyrrolidin-2-yl]methyl]-3-iodobenzamide.
| Compound Name | N-[[(2R)-1-ethylpyrrolidin-2-yl]methyl]-3-iodobenzamide |
|---|---|
| PubChem CID | 8839724 |
| Molecular Formula | C14H19IN2O |
| Molecular Weight | 358.22 g/mol |
| Exact Mass | 358.05 |
| IUPAC Name | N-[[(2R)-1-ethylpyrrolidin-2-yl]methyl]-3-iodobenzamide |
| SMILES | CCN1CCC[C@@H]1CNC(=O)c1cccc(I)c1 |
| InChI | InChI=1S/C14H19IN2O/c1-2-17-8-4-7-13(17)10-16-14(18)11-5-3-6-12(15)9-11/h3,5-6,9,13H,2,4,7-8,10H2,1H3,(H,16,18)/t13-/m1/s1 |
| InChIKey | OGKGPIBUYUITOQ-CYBMUJFWSA-N |
| XLogP | 2.51 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.22 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|