C14H19FN2O — CID 778881
N-[[(2S)-1-ethylpyrrolidin-2-yl]methyl]-4-fluorobenzamide (PubChem CID 778881) has the molecular formula C14H19FN2O and a molecular weight of 250.32 g/mol. Its IUPAC name is N-[[(2S)-1-ethylpyrrolidin-2-yl]methyl]-4-fluorobenzamide.
| Compound Name | N-[[(2S)-1-ethylpyrrolidin-2-yl]methyl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 778881 |
| Molecular Formula | C14H19FN2O |
| Molecular Weight | 250.32 g/mol |
| Exact Mass | 250.15 |
| IUPAC Name | N-[[(2S)-1-ethylpyrrolidin-2-yl]methyl]-4-fluorobenzamide |
| SMILES | CCN1CCC[C@H]1CNC(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C14H19FN2O/c1-2-17-9-3-4-13(17)10-16-14(18)11-5-7-12(15)8-6-11/h5-8,13H,2-4,9-10H2,1H3,(H,16,18)/t13-/m0/s1 |
| InChIKey | KXSZOAALIHQNFE-ZDUSSCGKSA-N |
| XLogP | 2.04 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.32 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |