C15H22ClFN2O3S — CID 129051547
N-[(1-ethylpyrrolidin-2-yl)methyl]-4-fluoro-3-methylsulfonylbenzamide;hydrochloride (PubChem CID 129051547) has the molecular formula C15H22ClFN2O3S and a molecular weight of 364.87 g/mol. Its IUPAC name is N-[(1-ethylpyrrolidin-2-yl)methyl]-4-fluoro-3-methylsulfonylbenzamide;hydrochloride.
| Compound Name | N-[(1-ethylpyrrolidin-2-yl)methyl]-4-fluoro-3-methylsulfonylbenzamide;hydrochloride |
|---|---|
| PubChem CID | 129051547 |
| Molecular Formula | C15H22ClFN2O3S |
| Molecular Weight | 364.87 g/mol |
| Exact Mass | 364.10 |
| IUPAC Name | N-[(1-ethylpyrrolidin-2-yl)methyl]-4-fluoro-3-methylsulfonylbenzamide;hydrochloride |
| SMILES | CCN1CCCC1CNC(=O)c1ccc(F)c(S(C)(=O)=O)c1.Cl |
| InChI | InChI=1S/C15H21FN2O3S.ClH/c1-3-18-8-4-5-12(18)10-17-15(19)11-6-7-13(16)14(9-11)22(2,20)21;/h6-7,9,12H,3-5,8,10H2,1-2H3,(H,17,19);1H |
| InChIKey | JVDBUTWMBFBGJE-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.87 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |