C10H14ClIN2OS — CID 119631709
[2-(aminomethyl)pyrrolidin-1-yl]-(5-iodothiophen-3-yl)methanone;hydrochloride (PubChem CID 119631709) has the molecular formula C10H14ClIN2OS and a molecular weight of 372.66 g/mol. Its IUPAC name is [2-(aminomethyl)pyrrolidin-1-yl]-(5-iodothiophen-3-yl)methanone;hydrochloride.
| Compound Name | [2-(aminomethyl)pyrrolidin-1-yl]-(5-iodothiophen-3-yl)methanone;hydrochloride |
|---|---|
| PubChem CID | 119631709 |
| Molecular Formula | C10H14ClIN2OS |
| Molecular Weight | 372.66 g/mol |
| Exact Mass | 371.96 |
| IUPAC Name | [2-(aminomethyl)pyrrolidin-1-yl]-(5-iodothiophen-3-yl)methanone;hydrochloride |
| SMILES | Cl.NCC1CCCN1C(=O)c1csc(I)c1 |
| InChI | InChI=1S/C10H13IN2OS.ClH/c11-9-4-7(6-15-9)10(14)13-3-1-2-8(13)5-12;/h4,6,8H,1-3,5,12H2;1H |
| InChIKey | IRSXAKFVMCHXRD-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.66 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|