C17H19N3O2S — CID 143191807
4-[4-[2-(aminomethyl)pyrrolidine-1-carbonyl]phenyl]thiophene-2-carboxamide (PubChem CID 143191807) has the molecular formula C17H19N3O2S and a molecular weight of 329.43 g/mol. Its IUPAC name is 4-[4-[2-(aminomethyl)pyrrolidine-1-carbonyl]phenyl]thiophene-2-carboxamide.
| Compound Name | 4-[4-[2-(aminomethyl)pyrrolidine-1-carbonyl]phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 143191807 |
| Molecular Formula | C17H19N3O2S |
| Molecular Weight | 329.43 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | 4-[4-[2-(aminomethyl)pyrrolidine-1-carbonyl]phenyl]thiophene-2-carboxamide |
| SMILES | NCC1CCCN1C(=O)c1ccc(-c2csc(C(N)=O)c2)cc1 |
| InChI | InChI=1S/C17H19N3O2S/c18-9-14-2-1-7-20(14)17(22)12-5-3-11(4-6-12)13-8-15(16(19)21)23-10-13/h3-6,8,10,14H,1-2,7,9,18H2,(H2,19,21) |
| InChIKey | OYNGFODBBIMPJH-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 89.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.43 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |