C10H13IN2OS — CID 81482957
[2-(aminomethyl)pyrrolidin-1-yl]-(5-iodothiophen-3-yl)methanone (PubChem CID 81482957) has the molecular formula C10H13IN2OS and a molecular weight of 336.20 g/mol. Its IUPAC name is [2-(aminomethyl)pyrrolidin-1-yl]-(5-iodothiophen-3-yl)methanone.
| Compound Name | [2-(aminomethyl)pyrrolidin-1-yl]-(5-iodothiophen-3-yl)methanone |
|---|---|
| PubChem CID | 81482957 |
| Molecular Formula | C10H13IN2OS |
| Molecular Weight | 336.20 g/mol |
| Exact Mass | 335.98 |
| IUPAC Name | [2-(aminomethyl)pyrrolidin-1-yl]-(5-iodothiophen-3-yl)methanone |
| SMILES | NCC1CCCN1C(=O)c1csc(I)c1 |
| InChI | InChI=1S/C10H13IN2OS/c11-9-4-7(6-15-9)10(14)13-3-1-2-8(13)5-12/h4,6,8H,1-3,5,12H2 |
| InChIKey | AINGLBZXENYOIW-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.20 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|