C11H17N3O3S2 — CID 124595434
5-[(2R)-2-(aminomethyl)pyrrolidine-1-carbonyl]-N-methylthiophene-3-sulfonamide (PubChem CID 124595434) has the molecular formula C11H17N3O3S2 and a molecular weight of 303.41 g/mol. Its IUPAC name is 5-[(2R)-2-(aminomethyl)pyrrolidine-1-carbonyl]-N-methylthiophene-3-sulfonamide.
| Compound Name | 5-[(2R)-2-(aminomethyl)pyrrolidine-1-carbonyl]-N-methylthiophene-3-sulfonamide |
|---|---|
| PubChem CID | 124595434 |
| Molecular Formula | C11H17N3O3S2 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | 5-[(2R)-2-(aminomethyl)pyrrolidine-1-carbonyl]-N-methylthiophene-3-sulfonamide |
| SMILES | CNS(=O)(=O)c1csc(C(=O)N2CCC[C@@H]2CN)c1 |
| InChI | InChI=1S/C11H17N3O3S2/c1-13-19(16,17)9-5-10(18-7-9)11(15)14-4-2-3-8(14)6-12/h5,7-8,13H,2-4,6,12H2,1H3/t8-/m1/s1 |
| InChIKey | ZOYBBAYPXYHKNO-MRVPVSSYSA-N |
| XLogP | 0.22 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |