C12H19N3O3S2 — CID 119651771
N-methyl-5-[2-(methylaminomethyl)pyrrolidine-1-carbonyl]thiophene-3-sulfonamide (PubChem CID 119651771) has the molecular formula C12H19N3O3S2 and a molecular weight of 317.44 g/mol. Its IUPAC name is N-methyl-5-[2-(methylaminomethyl)pyrrolidine-1-carbonyl]thiophene-3-sulfonamide.
| Compound Name | N-methyl-5-[2-(methylaminomethyl)pyrrolidine-1-carbonyl]thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 119651771 |
| Molecular Formula | C12H19N3O3S2 |
| Molecular Weight | 317.44 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | N-methyl-5-[2-(methylaminomethyl)pyrrolidine-1-carbonyl]thiophene-3-sulfonamide |
| SMILES | CNCC1CCCN1C(=O)c1cc(S(=O)(=O)NC)cs1 |
| InChI | InChI=1S/C12H19N3O3S2/c1-13-7-9-4-3-5-15(9)12(16)11-6-10(8-19-11)20(17,18)14-2/h6,8-9,13-14H,3-5,7H2,1-2H3 |
| InChIKey | PYLSSZWGFUAFKQ-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.44 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |