C14H22N4O4S2 — CID 119482039
N-(2-aminoethyl)-1-[4-(methylsulfamoyl)thiophene-2-carbonyl]piperidine-3-carboxamide (PubChem CID 119482039) has the molecular formula C14H22N4O4S2 and a molecular weight of 374.49 g/mol. Its IUPAC name is N-(2-aminoethyl)-1-[4-(methylsulfamoyl)thiophene-2-carbonyl]piperidine-3-carboxamide.
| Compound Name | N-(2-aminoethyl)-1-[4-(methylsulfamoyl)thiophene-2-carbonyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 119482039 |
| Molecular Formula | C14H22N4O4S2 |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.11 |
| IUPAC Name | N-(2-aminoethyl)-1-[4-(methylsulfamoyl)thiophene-2-carbonyl]piperidine-3-carboxamide |
| SMILES | CNS(=O)(=O)c1csc(C(=O)N2CCCC(C(=O)NCCN)C2)c1 |
| InChI | InChI=1S/C14H22N4O4S2/c1-16-24(21,22)11-7-12(23-9-11)14(20)18-6-2-3-10(8-18)13(19)17-5-4-15/h7,9-10,16H,2-6,8,15H2,1H3,(H,17,19) |
| InChIKey | YAERGDVSLCLUOP-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 121.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |