C15H19NO3S — CID 79696708
5-(4-hydroxybut-1-ynyl)-N-(2-hydroxycyclohexyl)thiophene-3-carboxamide (PubChem CID 79696708) has the molecular formula C15H19NO3S and a molecular weight of 293.39 g/mol. Its IUPAC name is 5-(4-hydroxybut-1-ynyl)-N-(2-hydroxycyclohexyl)thiophene-3-carboxamide.
| Compound Name | 5-(4-hydroxybut-1-ynyl)-N-(2-hydroxycyclohexyl)thiophene-3-carboxamide |
|---|---|
| PubChem CID | 79696708 |
| Molecular Formula | C15H19NO3S |
| Molecular Weight | 293.39 g/mol |
| Exact Mass | 293.11 |
| IUPAC Name | 5-(4-hydroxybut-1-ynyl)-N-(2-hydroxycyclohexyl)thiophene-3-carboxamide |
| SMILES | O=C(NC1CCCCC1O)c1csc(C#CCCO)c1 |
| InChI | InChI=1S/C15H19NO3S/c17-8-4-3-5-12-9-11(10-20-12)15(19)16-13-6-1-2-7-14(13)18/h9-10,13-14,17-18H,1-2,4,6-8H2,(H,16,19) |
| InChIKey | SVTOCOYROHIQBE-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.39 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|