C14H17NO4S2 — CID 81041008
N-[(1,1-dioxothiolan-2-yl)methyl]-5-(4-hydroxybut-1-ynyl)thiophene-3-carboxamide (PubChem CID 81041008) has the molecular formula C14H17NO4S2 and a molecular weight of 327.43 g/mol. Its IUPAC name is N-[(1,1-dioxothiolan-2-yl)methyl]-5-(4-hydroxybut-1-ynyl)thiophene-3-carboxamide.
| Compound Name | N-[(1,1-dioxothiolan-2-yl)methyl]-5-(4-hydroxybut-1-ynyl)thiophene-3-carboxamide |
|---|---|
| PubChem CID | 81041008 |
| Molecular Formula | C14H17NO4S2 |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.06 |
| IUPAC Name | N-[(1,1-dioxothiolan-2-yl)methyl]-5-(4-hydroxybut-1-ynyl)thiophene-3-carboxamide |
| SMILES | O=C(NCC1CCCS1(=O)=O)c1csc(C#CCCO)c1 |
| InChI | InChI=1S/C14H17NO4S2/c16-6-2-1-4-12-8-11(10-20-12)14(17)15-9-13-5-3-7-21(13,18)19/h8,10,13,16H,2-3,5-7,9H2,(H,15,17) |
| InChIKey | DTRRWRBIIWJGME-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|