C12H14BrNO3S — CID 81039516
3-bromo-N-[(1,1-dioxothiolan-2-yl)methyl]benzamide (PubChem CID 81039516) has the molecular formula C12H14BrNO3S and a molecular weight of 332.22 g/mol. Its IUPAC name is 3-bromo-N-[(1,1-dioxothiolan-2-yl)methyl]benzamide.
| Compound Name | 3-bromo-N-[(1,1-dioxothiolan-2-yl)methyl]benzamide |
|---|---|
| PubChem CID | 81039516 |
| Molecular Formula | C12H14BrNO3S |
| Molecular Weight | 332.22 g/mol |
| Exact Mass | 330.99 |
| IUPAC Name | 3-bromo-N-[(1,1-dioxothiolan-2-yl)methyl]benzamide |
| SMILES | O=C(NCC1CCCS1(=O)=O)c1cccc(Br)c1 |
| InChI | InChI=1S/C12H14BrNO3S/c13-10-4-1-3-9(7-10)12(15)14-8-11-5-2-6-18(11,16)17/h1,3-4,7,11H,2,5-6,8H2,(H,14,15) |
| InChIKey | GMRGVJLAYFOONF-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.22 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |