C12H13BrClNO3S — CID 103827085
3-bromo-5-chloro-N-[(1,1-dioxothiolan-2-yl)methyl]benzamide (PubChem CID 103827085) has the molecular formula C12H13BrClNO3S and a molecular weight of 366.66 g/mol. Its IUPAC name is 3-bromo-5-chloro-N-[(1,1-dioxothiolan-2-yl)methyl]benzamide.
| Compound Name | 3-bromo-5-chloro-N-[(1,1-dioxothiolan-2-yl)methyl]benzamide |
|---|---|
| PubChem CID | 103827085 |
| Molecular Formula | C12H13BrClNO3S |
| Molecular Weight | 366.66 g/mol |
| Exact Mass | 364.95 |
| IUPAC Name | 3-bromo-5-chloro-N-[(1,1-dioxothiolan-2-yl)methyl]benzamide |
| SMILES | O=C(NCC1CCCS1(=O)=O)c1cc(Cl)cc(Br)c1 |
| InChI | InChI=1S/C12H13BrClNO3S/c13-9-4-8(5-10(14)6-9)12(16)15-7-11-2-1-3-19(11,17)18/h4-6,11H,1-3,7H2,(H,15,16) |
| InChIKey | QZGBADIHRJJYCZ-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.66 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |