C12H15BrN2O3S — CID 81041972
3-amino-4-bromo-N-[(1,1-dioxothiolan-2-yl)methyl]benzamide (PubChem CID 81041972) has the molecular formula C12H15BrN2O3S and a molecular weight of 347.23 g/mol. Its IUPAC name is 3-amino-4-bromo-N-[(1,1-dioxothiolan-2-yl)methyl]benzamide.
| Compound Name | 3-amino-4-bromo-N-[(1,1-dioxothiolan-2-yl)methyl]benzamide |
|---|---|
| PubChem CID | 81041972 |
| Molecular Formula | C12H15BrN2O3S |
| Molecular Weight | 347.23 g/mol |
| Exact Mass | 346.00 |
| IUPAC Name | 3-amino-4-bromo-N-[(1,1-dioxothiolan-2-yl)methyl]benzamide |
| SMILES | Nc1cc(C(=O)NCC2CCCS2(=O)=O)ccc1Br |
| InChI | InChI=1S/C12H15BrN2O3S/c13-10-4-3-8(6-11(10)14)12(16)15-7-9-2-1-5-19(9,17)18/h3-4,6,9H,1-2,5,7,14H2,(H,15,16) |
| InChIKey | SVZPSICMBIUXRC-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.23 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|