C13H16N2O3S2 — CID 81038480
4-carbamothioyl-N-[(1,1-dioxothiolan-2-yl)methyl]benzamide (PubChem CID 81038480) has the molecular formula C13H16N2O3S2 and a molecular weight of 312.42 g/mol. Its IUPAC name is 4-carbamothioyl-N-[(1,1-dioxothiolan-2-yl)methyl]benzamide.
| Compound Name | 4-carbamothioyl-N-[(1,1-dioxothiolan-2-yl)methyl]benzamide |
|---|---|
| PubChem CID | 81038480 |
| Molecular Formula | C13H16N2O3S2 |
| Molecular Weight | 312.42 g/mol |
| Exact Mass | 312.06 |
| IUPAC Name | 4-carbamothioyl-N-[(1,1-dioxothiolan-2-yl)methyl]benzamide |
| SMILES | NC(=S)c1ccc(C(=O)NCC2CCCS2(=O)=O)cc1 |
| InChI | InChI=1S/C13H16N2O3S2/c14-12(19)9-3-5-10(6-4-9)13(16)15-8-11-2-1-7-20(11,17)18/h3-6,11H,1-2,7-8H2,(H2,14,19)(H,15,16) |
| InChIKey | COKHBFQTCNJSOQ-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.42 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|