C12H13ClN2O5S — CID 81042706
4-chloro-N-[(1,1-dioxothiolan-2-yl)methyl]-3-nitrobenzamide (PubChem CID 81042706) has the molecular formula C12H13ClN2O5S and a molecular weight of 332.77 g/mol. Its IUPAC name is 4-chloro-N-[(1,1-dioxothiolan-2-yl)methyl]-3-nitrobenzamide.
| Compound Name | 4-chloro-N-[(1,1-dioxothiolan-2-yl)methyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 81042706 |
| Molecular Formula | C12H13ClN2O5S |
| Molecular Weight | 332.77 g/mol |
| Exact Mass | 332.02 |
| IUPAC Name | 4-chloro-N-[(1,1-dioxothiolan-2-yl)methyl]-3-nitrobenzamide |
| SMILES | O=C(NCC1CCCS1(=O)=O)c1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H13ClN2O5S/c13-10-4-3-8(6-11(10)15(17)18)12(16)14-7-9-2-1-5-21(9,19)20/h3-4,6,9H,1-2,5,7H2,(H,14,16) |
| InChIKey | CYKNNNBZVUVVJU-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 106.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.77 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|