C12H14ClNO4S — CID 106502019
2-chloro-N-[(1,1-dioxothiolan-2-yl)methyl]-5-hydroxybenzamide (PubChem CID 106502019) has the molecular formula C12H14ClNO4S and a molecular weight of 303.77 g/mol. Its IUPAC name is 2-chloro-N-[(1,1-dioxothiolan-2-yl)methyl]-5-hydroxybenzamide.
| Compound Name | 2-chloro-N-[(1,1-dioxothiolan-2-yl)methyl]-5-hydroxybenzamide |
|---|---|
| PubChem CID | 106502019 |
| Molecular Formula | C12H14ClNO4S |
| Molecular Weight | 303.77 g/mol |
| Exact Mass | 303.03 |
| IUPAC Name | 2-chloro-N-[(1,1-dioxothiolan-2-yl)methyl]-5-hydroxybenzamide |
| SMILES | O=C(NCC1CCCS1(=O)=O)c1cc(O)ccc1Cl |
| InChI | InChI=1S/C12H14ClNO4S/c13-11-4-3-8(15)6-10(11)12(16)14-7-9-2-1-5-19(9,17)18/h3-4,6,9,15H,1-2,5,7H2,(H,14,16) |
| InChIKey | BYQOYSWVLZBKNE-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.77 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |