C13H17NO3S2 — CID 107032927
N-[(1,1-dioxothiolan-2-yl)methyl]-2-methyl-5-sulfanylbenzamide (PubChem CID 107032927) has the molecular formula C13H17NO3S2 and a molecular weight of 299.42 g/mol. Its IUPAC name is N-[(1,1-dioxothiolan-2-yl)methyl]-2-methyl-5-sulfanylbenzamide.
| Compound Name | N-[(1,1-dioxothiolan-2-yl)methyl]-2-methyl-5-sulfanylbenzamide |
|---|---|
| PubChem CID | 107032927 |
| Molecular Formula | C13H17NO3S2 |
| Molecular Weight | 299.42 g/mol |
| Exact Mass | 299.06 |
| IUPAC Name | N-[(1,1-dioxothiolan-2-yl)methyl]-2-methyl-5-sulfanylbenzamide |
| SMILES | Cc1ccc(S)cc1C(=O)NCC1CCCS1(=O)=O |
| InChI | InChI=1S/C13H17NO3S2/c1-9-4-5-10(18)7-12(9)13(15)14-8-11-3-2-6-19(11,16)17/h4-5,7,11,18H,2-3,6,8H2,1H3,(H,14,15) |
| InChIKey | AFYZIXCUHUEFNX-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.42 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|