C15H20FNO3S — CID 138035017
N-[(1,1-dioxothian-2-yl)methyl]-4-fluoro-2,6-dimethylbenzamide (PubChem CID 138035017) has the molecular formula C15H20FNO3S and a molecular weight of 313.39 g/mol. Its IUPAC name is N-[(1,1-dioxothian-2-yl)methyl]-4-fluoro-2,6-dimethylbenzamide.
| Compound Name | N-[(1,1-dioxothian-2-yl)methyl]-4-fluoro-2,6-dimethylbenzamide |
|---|---|
| PubChem CID | 138035017 |
| Molecular Formula | C15H20FNO3S |
| Molecular Weight | 313.39 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | N-[(1,1-dioxothian-2-yl)methyl]-4-fluoro-2,6-dimethylbenzamide |
| SMILES | Cc1cc(F)cc(C)c1C(=O)NCC1CCCCS1(=O)=O |
| InChI | InChI=1S/C15H20FNO3S/c1-10-7-12(16)8-11(2)14(10)15(18)17-9-13-5-3-4-6-21(13,19)20/h7-8,13H,3-6,9H2,1-2H3,(H,17,18) |
| InChIKey | RTMAVDMJEVFEIS-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.39 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |