C14H17FO3S — CID 106876995
(1,1-dioxothian-2-yl)-(4-fluoro-2,6-dimethylphenyl)methanone (PubChem CID 106876995) has the molecular formula C14H17FO3S and a molecular weight of 284.35 g/mol. Its IUPAC name is (1,1-dioxothian-2-yl)-(4-fluoro-2,6-dimethylphenyl)methanone.
| Compound Name | (1,1-dioxothian-2-yl)-(4-fluoro-2,6-dimethylphenyl)methanone |
|---|---|
| PubChem CID | 106876995 |
| Molecular Formula | C14H17FO3S |
| Molecular Weight | 284.35 g/mol |
| Exact Mass | 284.09 |
| IUPAC Name | (1,1-dioxothian-2-yl)-(4-fluoro-2,6-dimethylphenyl)methanone |
| SMILES | Cc1cc(F)cc(C)c1C(=O)C1CCCCS1(=O)=O |
| InChI | InChI=1S/C14H17FO3S/c1-9-7-11(15)8-10(2)13(9)14(16)12-5-3-4-6-19(12,17)18/h7-8,12H,3-6H2,1-2H3 |
| InChIKey | FINRTUUENUQHCB-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.35 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |