C12H10Cl4O3S — CID 105349402
(1,1-dioxothian-2-yl)-(2,3,4,6-tetrachlorophenyl)methanone (PubChem CID 105349402) has the molecular formula C12H10Cl4O3S and a molecular weight of 376.09 g/mol. Its IUPAC name is (1,1-dioxothian-2-yl)-(2,3,4,6-tetrachlorophenyl)methanone.
| Compound Name | (1,1-dioxothian-2-yl)-(2,3,4,6-tetrachlorophenyl)methanone |
|---|---|
| PubChem CID | 105349402 |
| Molecular Formula | C12H10Cl4O3S |
| Molecular Weight | 376.09 g/mol |
| Exact Mass | 373.91 |
| IUPAC Name | (1,1-dioxothian-2-yl)-(2,3,4,6-tetrachlorophenyl)methanone |
| SMILES | O=C(c1c(Cl)cc(Cl)c(Cl)c1Cl)C1CCCCS1(=O)=O |
| InChI | InChI=1S/C12H10Cl4O3S/c13-6-5-7(14)10(15)11(16)9(6)12(17)8-3-1-2-4-20(8,18)19/h5,8H,1-4H2 |
| InChIKey | BZCVTICJRLQBIV-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.09 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|