C12H13BrClNO3S — CID 113418940
N-(3-bromo-4-chlorophenyl)-1,1-dioxothiane-2-carboxamide (PubChem CID 113418940) has the molecular formula C12H13BrClNO3S and a molecular weight of 366.66 g/mol. Its IUPAC name is N-(3-bromo-4-chlorophenyl)-1,1-dioxothiane-2-carboxamide.
| Compound Name | N-(3-bromo-4-chlorophenyl)-1,1-dioxothiane-2-carboxamide |
|---|---|
| PubChem CID | 113418940 |
| Molecular Formula | C12H13BrClNO3S |
| Molecular Weight | 366.66 g/mol |
| Exact Mass | 364.95 |
| IUPAC Name | N-(3-bromo-4-chlorophenyl)-1,1-dioxothiane-2-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)c(Br)c1)C1CCCCS1(=O)=O |
| InChI | InChI=1S/C12H13BrClNO3S/c13-9-7-8(4-5-10(9)14)15-12(16)11-3-1-2-6-19(11,17)18/h4-5,7,11H,1-3,6H2,(H,15,16) |
| InChIKey | OKLHAVCTKOLPKS-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.66 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |