C12H14BrNO3S — CID 113422098
N-(4-bromophenyl)-1,1-dioxothiane-2-carboxamide (PubChem CID 113422098) has the molecular formula C12H14BrNO3S and a molecular weight of 332.22 g/mol. Its IUPAC name is N-(4-bromophenyl)-1,1-dioxothiane-2-carboxamide.
| Compound Name | N-(4-bromophenyl)-1,1-dioxothiane-2-carboxamide |
|---|---|
| PubChem CID | 113422098 |
| Molecular Formula | C12H14BrNO3S |
| Molecular Weight | 332.22 g/mol |
| Exact Mass | 330.99 |
| IUPAC Name | N-(4-bromophenyl)-1,1-dioxothiane-2-carboxamide |
| SMILES | O=C(Nc1ccc(Br)cc1)C1CCCCS1(=O)=O |
| InChI | InChI=1S/C12H14BrNO3S/c13-9-4-6-10(7-5-9)14-12(15)11-3-1-2-8-18(11,16)17/h4-7,11H,1-3,8H2,(H,14,15) |
| InChIKey | LBRBNVWFFLXVKB-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.22 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |