C12H12BrF2NO3S — CID 104519521
N-(4-bromo-2,6-difluorophenyl)-1,1-dioxothiane-2-carboxamide (PubChem CID 104519521) has the molecular formula C12H12BrF2NO3S and a molecular weight of 368.20 g/mol. Its IUPAC name is N-(4-bromo-2,6-difluorophenyl)-1,1-dioxothiane-2-carboxamide.
| Compound Name | N-(4-bromo-2,6-difluorophenyl)-1,1-dioxothiane-2-carboxamide |
|---|---|
| PubChem CID | 104519521 |
| Molecular Formula | C12H12BrF2NO3S |
| Molecular Weight | 368.20 g/mol |
| Exact Mass | 366.97 |
| IUPAC Name | N-(4-bromo-2,6-difluorophenyl)-1,1-dioxothiane-2-carboxamide |
| SMILES | O=C(Nc1c(F)cc(Br)cc1F)C1CCCCS1(=O)=O |
| InChI | InChI=1S/C12H12BrF2NO3S/c13-7-5-8(14)11(9(15)6-7)16-12(17)10-3-1-2-4-20(10,18)19/h5-6,10H,1-4H2,(H,16,17) |
| InChIKey | KENPEKLBXTYYJS-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.20 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |