C12H14F2N2O3S — CID 104517283
N-(5-amino-2,4-difluorophenyl)-1,1-dioxothiane-2-carboxamide (PubChem CID 104517283) has the molecular formula C12H14F2N2O3S and a molecular weight of 304.32 g/mol. Its IUPAC name is N-(5-amino-2,4-difluorophenyl)-1,1-dioxothiane-2-carboxamide.
| Compound Name | N-(5-amino-2,4-difluorophenyl)-1,1-dioxothiane-2-carboxamide |
|---|---|
| PubChem CID | 104517283 |
| Molecular Formula | C12H14F2N2O3S |
| Molecular Weight | 304.32 g/mol |
| Exact Mass | 304.07 |
| IUPAC Name | N-(5-amino-2,4-difluorophenyl)-1,1-dioxothiane-2-carboxamide |
| SMILES | Nc1cc(NC(=O)C2CCCCS2(=O)=O)c(F)cc1F |
| InChI | InChI=1S/C12H14F2N2O3S/c13-7-5-8(14)10(6-9(7)15)16-12(17)11-3-1-2-4-20(11,18)19/h5-6,11H,1-4,15H2,(H,16,17) |
| InChIKey | RPDQKNJCQLTXPW-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.32 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|