C11H14F2N2 — CID 82933880
3-N-cyclopentyl-4,6-difluorobenzene-1,3-diamine (PubChem CID 82933880) has the molecular formula C11H14F2N2 and a molecular weight of 212.24 g/mol. Its IUPAC name is 3-N-cyclopentyl-4,6-difluorobenzene-1,3-diamine.
| Compound Name | 3-N-cyclopentyl-4,6-difluorobenzene-1,3-diamine |
|---|---|
| PubChem CID | 82933880 |
| Molecular Formula | C11H14F2N2 |
| Molecular Weight | 212.24 g/mol |
| Exact Mass | 212.11 |
| IUPAC Name | 3-N-cyclopentyl-4,6-difluorobenzene-1,3-diamine |
| SMILES | Nc1cc(NC2CCCC2)c(F)cc1F |
| InChI | InChI=1S/C11H14F2N2/c12-8-5-9(13)11(6-10(8)14)15-7-3-1-2-4-7/h5-7,15H,1-4,14H2 |
| InChIKey | ZCCBDFOEONCXLA-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.24 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|