C12H14F2N2O — CID 61091643
5-amino-N-cyclopentyl-2,4-difluorobenzamide (PubChem CID 61091643) has the molecular formula C12H14F2N2O and a molecular weight of 240.25 g/mol. Its IUPAC name is 5-amino-N-cyclopentyl-2,4-difluorobenzamide.
| Compound Name | 5-amino-N-cyclopentyl-2,4-difluorobenzamide |
|---|---|
| PubChem CID | 61091643 |
| Molecular Formula | C12H14F2N2O |
| Molecular Weight | 240.25 g/mol |
| Exact Mass | 240.11 |
| IUPAC Name | 5-amino-N-cyclopentyl-2,4-difluorobenzamide |
| SMILES | Nc1cc(C(=O)NC2CCCC2)c(F)cc1F |
| InChI | InChI=1S/C12H14F2N2O/c13-9-6-10(14)11(15)5-8(9)12(17)16-7-3-1-2-4-7/h5-7H,1-4,15H2,(H,16,17) |
| InChIKey | SRMPMCXEBGJYLZ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.25 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|