C11H12F2N2O3S — CID 61090998
5-amino-N-(1,1-dioxothiolan-3-yl)-2,4-difluorobenzamide (PubChem CID 61090998) has the molecular formula C11H12F2N2O3S and a molecular weight of 290.29 g/mol. Its IUPAC name is 5-amino-N-(1,1-dioxothiolan-3-yl)-2,4-difluorobenzamide.
| Compound Name | 5-amino-N-(1,1-dioxothiolan-3-yl)-2,4-difluorobenzamide |
|---|---|
| PubChem CID | 61090998 |
| Molecular Formula | C11H12F2N2O3S |
| Molecular Weight | 290.29 g/mol |
| Exact Mass | 290.05 |
| IUPAC Name | 5-amino-N-(1,1-dioxothiolan-3-yl)-2,4-difluorobenzamide |
| SMILES | Nc1cc(C(=O)NC2CCS(=O)(=O)C2)c(F)cc1F |
| InChI | InChI=1S/C11H12F2N2O3S/c12-8-4-9(13)10(14)3-7(8)11(16)15-6-1-2-19(17,18)5-6/h3-4,6H,1-2,5,14H2,(H,15,16) |
| InChIKey | MXMCLMDPBRQGFE-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.29 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|